C18H15F6N3O2S2 — CID 3719187
N-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-1,3-benzothiazol-6-yl]-4,4,4-trifluoro-3-(trifluoromethyl)butanamide (PubChem CID 3719187) has the molecular formula C18H15F6N3O2S2 and a molecular weight of 483.46 g/mol. Its IUPAC name is N-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-1,3-benzothiazol-6-yl]-4,4,4-trifluoro-3-(trifluoromethyl)butanamide.
| Compound Name | N-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-1,3-benzothiazol-6-yl]-4,4,4-trifluoro-3-(trifluoromethyl)butanamide |
|---|---|
| PubChem CID | 3719187 |
| Molecular Formula | C18H15F6N3O2S2 |
| Molecular Weight | 483.46 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | N-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-1,3-benzothiazol-6-yl]-4,4,4-trifluoro-3-(trifluoromethyl)butanamide |
| SMILES | Cc1noc(C)c1CSc1nc2ccc(NC(=O)CC(C(F)(F)F)C(F)(F)F)cc2s1 |
| InChI | InChI=1S/C18H15F6N3O2S2/c1-8-11(9(2)29-27-8)7-30-16-26-12-4-3-10(5-13(12)31-16)25-15(28)6-14(17(19,20)21)18(22,23)24/h3-5,14H,6-7H2,1-2H3,(H,25,28) |
| InChIKey | QPHUEOYAMFTHIP-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.46 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |