C11H8F2N4O3 — CID 115630128
4,5-difluoro-N-(4-methyl-1H-pyrazol-5-yl)-2-nitrobenzamide (PubChem CID 115630128) has the molecular formula C11H8F2N4O3 and a molecular weight of 282.21 g/mol. Its IUPAC name is 4,5-difluoro-N-(4-methyl-1H-pyrazol-5-yl)-2-nitrobenzamide.
| Compound Name | 4,5-difluoro-N-(4-methyl-1H-pyrazol-5-yl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 115630128 |
| Molecular Formula | C11H8F2N4O3 |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 4,5-difluoro-N-(4-methyl-1H-pyrazol-5-yl)-2-nitrobenzamide |
| SMILES | Cc1cn[nH]c1NC(=O)c1cc(F)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H8F2N4O3/c1-5-4-14-16-10(5)15-11(18)6-2-7(12)8(13)3-9(6)17(19)20/h2-4H,1H3,(H2,14,15,16,18) |
| InChIKey | NIUDDEMEXRWINW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|