C13H13N3O4S — CID 61465540
4-[(4,5-dimethyl-1,3-thiazol-2-yl)carbamoylamino]-3-hydroxybenzoic acid (PubChem CID 61465540) has the molecular formula C13H13N3O4S and a molecular weight of 307.33 g/mol. Its IUPAC name is 4-[(4,5-dimethyl-1,3-thiazol-2-yl)carbamoylamino]-3-hydroxybenzoic acid.
| Compound Name | 4-[(4,5-dimethyl-1,3-thiazol-2-yl)carbamoylamino]-3-hydroxybenzoic acid |
|---|---|
| PubChem CID | 61465540 |
| Molecular Formula | C13H13N3O4S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 4-[(4,5-dimethyl-1,3-thiazol-2-yl)carbamoylamino]-3-hydroxybenzoic acid |
| SMILES | Cc1nc(NC(=O)Nc2ccc(C(=O)O)cc2O)sc1C |
| InChI | InChI=1S/C13H13N3O4S/c1-6-7(2)21-13(14-6)16-12(20)15-9-4-3-8(11(18)19)5-10(9)17/h3-5,17H,1-2H3,(H,18,19)(H2,14,15,16,20) |
| InChIKey | GPBIXWBZJYZBRA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|