C12H17ClN2O3Sn2 — CID 141403656
CID 141403656 (PubChem CID 141403656) has the molecular formula C12H17ClN2O3Sn2 and a molecular weight of 510.15 g/mol.
| Compound Name | CID 141403656 |
|---|---|
| PubChem CID | 141403656 |
| Molecular Formula | C12H17ClN2O3Sn2 |
| Molecular Weight | 510.15 g/mol |
| Exact Mass | 511.90 |
| IUPAC Name | — |
| SMILES | COC(=O)c1nc([Sn])cc(NC(C)=O)c1Cl.C[Sn](C)C |
| InChI | InChI=1S/C9H8ClN2O3.3CH3.2Sn/c1-5(13)12-6-3-4-11-8(7(6)10)9(14)15-2;;;;;/h3H,1-2H3,(H,11,12,13);3*1H3;; |
| InChIKey | YKBLSEJWRQXWEL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.15 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |