C10H10Cl2N2O2 — CID 146259289
N-[3,6-dichloro-2-(1-methoxyethenyl)-4-pyridinyl]acetamide (PubChem CID 146259289) has the molecular formula C10H10Cl2N2O2 and a molecular weight of 261.11 g/mol. Its IUPAC name is N-[3,6-dichloro-2-(1-methoxyethenyl)-4-pyridinyl]acetamide.
| Compound Name | N-[3,6-dichloro-2-(1-methoxyethenyl)-4-pyridinyl]acetamide |
|---|---|
| PubChem CID | 146259289 |
| Molecular Formula | C10H10Cl2N2O2 |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | N-[3,6-dichloro-2-(1-methoxyethenyl)-4-pyridinyl]acetamide |
| SMILES | C=C(OC)c1nc(Cl)cc(NC(C)=O)c1Cl |
| InChI | InChI=1S/C10H10Cl2N2O2/c1-5(16-3)10-9(12)7(13-6(2)15)4-8(11)14-10/h4H,1H2,2-3H3,(H,13,14,15) |
| InChIKey | LREYWRJSLQEPLM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|