C17H13ClN2O4 — CID 22677410
methyl 4-acetamido-6-(1-benzofuran-2-yl)-3-chloropyridine-2-carboxylate (PubChem CID 22677410) has the molecular formula C17H13ClN2O4 and a molecular weight of 344.75 g/mol. Its IUPAC name is methyl 4-acetamido-6-(1-benzofuran-2-yl)-3-chloropyridine-2-carboxylate.
| Compound Name | methyl 4-acetamido-6-(1-benzofuran-2-yl)-3-chloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 22677410 |
| Molecular Formula | C17H13ClN2O4 |
| Molecular Weight | 344.75 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | methyl 4-acetamido-6-(1-benzofuran-2-yl)-3-chloropyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(-c2cc3ccccc3o2)cc(NC(C)=O)c1Cl |
| InChI | InChI=1S/C17H13ClN2O4/c1-9(21)19-12-8-11(20-16(15(12)18)17(22)23-2)14-7-10-5-3-4-6-13(10)24-14/h3-8H,1-2H3,(H,19,20,21) |
| InChIKey | DAJUKFWOWUSBIT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.75 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |