C9H7F4N3O — CID 15290113
N-(diaminomethylidene)-2-fluoro-3-(trifluoromethyl)benzamide (PubChem CID 15290113) has the molecular formula C9H7F4N3O and a molecular weight of 249.17 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-fluoro-3-(trifluoromethyl)benzamide.
| Compound Name | N-(diaminomethylidene)-2-fluoro-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 15290113 |
| Molecular Formula | C9H7F4N3O |
| Molecular Weight | 249.17 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | N-(diaminomethylidene)-2-fluoro-3-(trifluoromethyl)benzamide |
| SMILES | NC(N)=NC(=O)c1cccc(C(F)(F)F)c1F |
| InChI | InChI=1S/C9H7F4N3O/c10-6-4(7(17)16-8(14)15)2-1-3-5(6)9(11,12)13/h1-3H,(H4,14,15,16,17) |
| InChIKey | NUEHEGJNOAMJPX-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.17 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|