C16H11F5N4O — CID 135275969
N-[(2Z)-1-amino-2-[(2,6-difluorophenyl)hydrazinylidene]ethylidene]-2-(trifluoromethyl)benzamide (PubChem CID 135275969) has the molecular formula C16H11F5N4O and a molecular weight of 370.28 g/mol. Its IUPAC name is N-[(2Z)-1-amino-2-[(2,6-difluorophenyl)hydrazinylidene]ethylidene]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[(2Z)-1-amino-2-[(2,6-difluorophenyl)hydrazinylidene]ethylidene]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 135275969 |
| Molecular Formula | C16H11F5N4O |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | N-[(2Z)-1-amino-2-[(2,6-difluorophenyl)hydrazinylidene]ethylidene]-2-(trifluoromethyl)benzamide |
| SMILES | NC(/C=N\Nc1c(F)cccc1F)=N\C(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H11F5N4O/c17-11-6-3-7-12(18)14(11)25-23-8-13(22)24-15(26)9-4-1-2-5-10(9)16(19,20)21/h1-8,25H,(H2,22,24,26)/b23-8- |
| InChIKey | PZJOFGMTPGDZOA-NYAPKIOYSA-N |
| XLogP | 3.58 |
| TPSA | 79.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|