C8H6F4N2O — CID 83403332
[2-fluoro-6-(trifluoromethyl)phenyl]urea (PubChem CID 83403332) has the molecular formula C8H6F4N2O and a molecular weight of 222.14 g/mol. Its IUPAC name is [2-fluoro-6-(trifluoromethyl)phenyl]urea.
| Compound Name | [2-fluoro-6-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 83403332 |
| Molecular Formula | C8H6F4N2O |
| Molecular Weight | 222.14 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | [2-fluoro-6-(trifluoromethyl)phenyl]urea |
| SMILES | NC(=O)Nc1c(F)cccc1C(F)(F)F |
| InChI | InChI=1S/C8H6F4N2O/c9-5-3-1-2-4(8(10,11)12)6(5)14-7(13)15/h1-3H,(H3,13,14,15) |
| InChIKey | UNADWBGSJMLRRB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.14 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |