C8H9F6N2O4P — CID 138620046
[2,6-bis(trifluoromethyl)phenyl]hydrazine;phosphoric acid (PubChem CID 138620046) has the molecular formula C8H9F6N2O4P and a molecular weight of 342.13 g/mol. Its IUPAC name is [2,6-bis(trifluoromethyl)phenyl]hydrazine;phosphoric acid.
| Compound Name | [2,6-bis(trifluoromethyl)phenyl]hydrazine;phosphoric acid |
|---|---|
| PubChem CID | 138620046 |
| Molecular Formula | C8H9F6N2O4P |
| Molecular Weight | 342.13 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | [2,6-bis(trifluoromethyl)phenyl]hydrazine;phosphoric acid |
| SMILES | NNc1c(C(F)(F)F)cccc1C(F)(F)F.O=P(O)(O)O |
| InChI | InChI=1S/C8H6F6N2.H3O4P/c9-7(10,11)4-2-1-3-5(6(4)16-15)8(12,13)14;1-5(2,3)4/h1-3,16H,15H2;(H3,1,2,3,4) |
| InChIKey | XGNIBYZHDUVNEB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.13 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|