C18H12F4N4O — CID 67961392
N-(diaminomethylidene)-4-[2-fluoro-5-(trifluoromethyl)phenyl]quinoline-6-carboxamide (PubChem CID 67961392) has the molecular formula C18H12F4N4O and a molecular weight of 376.31 g/mol. Its IUPAC name is N-(diaminomethylidene)-4-[2-fluoro-5-(trifluoromethyl)phenyl]quinoline-6-carboxamide.
| Compound Name | N-(diaminomethylidene)-4-[2-fluoro-5-(trifluoromethyl)phenyl]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 67961392 |
| Molecular Formula | C18H12F4N4O |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | N-(diaminomethylidene)-4-[2-fluoro-5-(trifluoromethyl)phenyl]quinoline-6-carboxamide |
| SMILES | NC(N)=NC(=O)c1ccc2nccc(-c3cc(C(F)(F)F)ccc3F)c2c1 |
| InChI | InChI=1S/C18H12F4N4O/c19-14-3-2-10(18(20,21)22)8-12(14)11-5-6-25-15-4-1-9(7-13(11)15)16(27)26-17(23)24/h1-8H,(H4,23,24,26,27) |
| InChIKey | BGHOLMYRISUFCC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|