C17H12ClFN4O — CID 67961427
4-(2-chloro-5-fluorophenyl)-N-(diaminomethylidene)quinoline-6-carboxamide (PubChem CID 67961427) has the molecular formula C17H12ClFN4O and a molecular weight of 342.76 g/mol. Its IUPAC name is 4-(2-chloro-5-fluorophenyl)-N-(diaminomethylidene)quinoline-6-carboxamide.
| Compound Name | 4-(2-chloro-5-fluorophenyl)-N-(diaminomethylidene)quinoline-6-carboxamide |
|---|---|
| PubChem CID | 67961427 |
| Molecular Formula | C17H12ClFN4O |
| Molecular Weight | 342.76 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 4-(2-chloro-5-fluorophenyl)-N-(diaminomethylidene)quinoline-6-carboxamide |
| SMILES | NC(N)=NC(=O)c1ccc2nccc(-c3cc(F)ccc3Cl)c2c1 |
| InChI | InChI=1S/C17H12ClFN4O/c18-14-3-2-10(19)8-12(14)11-5-6-22-15-4-1-9(7-13(11)15)16(24)23-17(20)21/h1-8H,(H4,20,21,23,24) |
| InChIKey | KRPLCTRVWGMGMU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.76 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|