C18H12F3N5O2 — CID 67961397
6-N-(diaminomethylidene)-4-(2,4,6-trifluorophenyl)quinoline-2,6-dicarboxamide (PubChem CID 67961397) has the molecular formula C18H12F3N5O2 and a molecular weight of 387.32 g/mol. Its IUPAC name is 6-N-(diaminomethylidene)-4-(2,4,6-trifluorophenyl)quinoline-2,6-dicarboxamide.
| Compound Name | 6-N-(diaminomethylidene)-4-(2,4,6-trifluorophenyl)quinoline-2,6-dicarboxamide |
|---|---|
| PubChem CID | 67961397 |
| Molecular Formula | C18H12F3N5O2 |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 6-N-(diaminomethylidene)-4-(2,4,6-trifluorophenyl)quinoline-2,6-dicarboxamide |
| SMILES | NC(=O)c1cc(-c2c(F)cc(F)cc2F)c2cc(C(=O)N=C(N)N)ccc2n1 |
| InChI | InChI=1S/C18H12F3N5O2/c19-8-4-11(20)15(12(21)5-8)10-6-14(16(22)27)25-13-2-1-7(3-9(10)13)17(28)26-18(23)24/h1-6H,(H2,22,27)(H4,23,24,26,28) |
| InChIKey | XNFKROWLEDQNEN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 137.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|