C20H19FN4O2 — CID 67962013
N-(diaminomethylidene)-4-(2-fluoro-6-methoxyphenyl)-2,3-dimethylquinoline-6-carboxamide (PubChem CID 67962013) has the molecular formula C20H19FN4O2 and a molecular weight of 366.40 g/mol. Its IUPAC name is N-(diaminomethylidene)-4-(2-fluoro-6-methoxyphenyl)-2,3-dimethylquinoline-6-carboxamide.
| Compound Name | N-(diaminomethylidene)-4-(2-fluoro-6-methoxyphenyl)-2,3-dimethylquinoline-6-carboxamide |
|---|---|
| PubChem CID | 67962013 |
| Molecular Formula | C20H19FN4O2 |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-(diaminomethylidene)-4-(2-fluoro-6-methoxyphenyl)-2,3-dimethylquinoline-6-carboxamide |
| SMILES | COc1cccc(F)c1-c1c(C)c(C)nc2ccc(C(=O)N=C(N)N)cc12 |
| InChI | InChI=1S/C20H19FN4O2/c1-10-11(2)24-15-8-7-12(19(26)25-20(22)23)9-13(15)17(10)18-14(21)5-4-6-16(18)27-3/h4-9H,1-3H3,(H4,22,23,25,26) |
| InChIKey | XMQRPWZJKFDZOG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|