C20H18FNO2 — CID 67967694
1-[4-(2-fluoro-6-methoxyphenyl)-2,3-dimethylquinolin-6-yl]ethenol (PubChem CID 67967694) has the molecular formula C20H18FNO2 and a molecular weight of 323.37 g/mol. Its IUPAC name is 1-[4-(2-fluoro-6-methoxyphenyl)-2,3-dimethylquinolin-6-yl]ethenol.
| Compound Name | 1-[4-(2-fluoro-6-methoxyphenyl)-2,3-dimethylquinolin-6-yl]ethenol |
|---|---|
| PubChem CID | 67967694 |
| Molecular Formula | C20H18FNO2 |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 1-[4-(2-fluoro-6-methoxyphenyl)-2,3-dimethylquinolin-6-yl]ethenol |
| SMILES | C=C(O)c1ccc2nc(C)c(C)c(-c3c(F)cccc3OC)c2c1 |
| InChI | InChI=1S/C20H18FNO2/c1-11-12(2)22-17-9-8-14(13(3)23)10-15(17)19(11)20-16(21)6-5-7-18(20)24-4/h5-10,23H,3H2,1-2,4H3 |
| InChIKey | UHUVNMGPGWBAMJ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|