C10H10FN3O2 — CID 22078535
3-acetyl-N-(diaminomethylidene)-4-fluorobenzamide (PubChem CID 22078535) has the molecular formula C10H10FN3O2 and a molecular weight of 223.21 g/mol. Its IUPAC name is 3-acetyl-N-(diaminomethylidene)-4-fluorobenzamide.
| Compound Name | 3-acetyl-N-(diaminomethylidene)-4-fluorobenzamide |
|---|---|
| PubChem CID | 22078535 |
| Molecular Formula | C10H10FN3O2 |
| Molecular Weight | 223.21 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 3-acetyl-N-(diaminomethylidene)-4-fluorobenzamide |
| SMILES | CC(=O)c1cc(C(=O)N=C(N)N)ccc1F |
| InChI | InChI=1S/C10H10FN3O2/c1-5(15)7-4-6(2-3-8(7)11)9(16)14-10(12)13/h2-4H,1H3,(H4,12,13,14,16) |
| InChIKey | KTKVQOAEICBTJO-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.21 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|