C15H10F3NO2 — CID 118684023
5-acetyl-N-(3,4-difluorophenyl)-2-fluorobenzamide (PubChem CID 118684023) has the molecular formula C15H10F3NO2 and a molecular weight of 293.24 g/mol. Its IUPAC name is 5-acetyl-N-(3,4-difluorophenyl)-2-fluorobenzamide.
| Compound Name | 5-acetyl-N-(3,4-difluorophenyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 118684023 |
| Molecular Formula | C15H10F3NO2 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 5-acetyl-N-(3,4-difluorophenyl)-2-fluorobenzamide |
| SMILES | CC(=O)c1ccc(F)c(C(=O)Nc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C15H10F3NO2/c1-8(20)9-2-4-12(16)11(6-9)15(21)19-10-3-5-13(17)14(18)7-10/h2-7H,1H3,(H,19,21) |
| InChIKey | XUBSVPXVUFFZAO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |