C9H11N3O4S — CID 23359361
N-(diaminomethylidene)-4-hydroxy-3-methylsulfonylbenzamide (PubChem CID 23359361) has the molecular formula C9H11N3O4S and a molecular weight of 257.27 g/mol. Its IUPAC name is N-(diaminomethylidene)-4-hydroxy-3-methylsulfonylbenzamide.
| Compound Name | N-(diaminomethylidene)-4-hydroxy-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 23359361 |
| Molecular Formula | C9H11N3O4S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | N-(diaminomethylidene)-4-hydroxy-3-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1cc(C(=O)N=C(N)N)ccc1O |
| InChI | InChI=1S/C9H11N3O4S/c1-17(15,16)7-4-5(2-3-6(7)13)8(14)12-9(10)11/h2-4,13H,1H3,(H4,10,11,12,14) |
| InChIKey | GBYNCBMEFJBAOM-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 135.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|