C13H19N3O4S — CID 19096152
N-(diaminomethylidene)-4-(2-methylpropoxy)-3-methylsulfonylbenzamide (PubChem CID 19096152) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is N-(diaminomethylidene)-4-(2-methylpropoxy)-3-methylsulfonylbenzamide.
| Compound Name | N-(diaminomethylidene)-4-(2-methylpropoxy)-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 19096152 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | N-(diaminomethylidene)-4-(2-methylpropoxy)-3-methylsulfonylbenzamide |
| SMILES | CC(C)COc1ccc(C(=O)N=C(N)N)cc1S(C)(=O)=O |
| InChI | InChI=1S/C13H19N3O4S/c1-8(2)7-20-10-5-4-9(12(17)16-13(14)15)6-11(10)21(3,18)19/h4-6,8H,7H2,1-3H3,(H4,14,15,16,17) |
| InChIKey | LZPIKVCNZAEDKN-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|