C20H21N5O4S2 — CID 18788835
N-(diaminomethylidene)-4-[4-[2-(4,5-dihydro-1H-imidazol-2-yl)ethanethioyl]phenoxy]-3-methylsulfonylbenzamide (PubChem CID 18788835) has the molecular formula C20H21N5O4S2 and a molecular weight of 459.55 g/mol. Its IUPAC name is N-(diaminomethylidene)-4-[4-[2-(4,5-dihydro-1H-imidazol-2-yl)ethanethioyl]phenoxy]-3-methylsulfonylbenzamide.
| Compound Name | N-(diaminomethylidene)-4-[4-[2-(4,5-dihydro-1H-imidazol-2-yl)ethanethioyl]phenoxy]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 18788835 |
| Molecular Formula | C20H21N5O4S2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | N-(diaminomethylidene)-4-[4-[2-(4,5-dihydro-1H-imidazol-2-yl)ethanethioyl]phenoxy]-3-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1cc(C(=O)N=C(N)N)ccc1Oc1ccc(C(=S)CC2=NCCN2)cc1 |
| InChI | InChI=1S/C20H21N5O4S2/c1-31(27,28)17-10-13(19(26)25-20(21)22)4-7-15(17)29-14-5-2-12(3-6-14)16(30)11-18-23-8-9-24-18/h2-7,10H,8-9,11H2,1H3,(H,23,24)(H4,21,22,25,26) |
| InChIKey | ICDZDTSIQZQZKA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 149.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|