C24H25Cl2N5O5S2 — CID 18788818
4-[4-[2-(1H-benzimidazol-2-ylsulfanyl)-1-hydroxyethyl]phenoxy]-N-(diaminomethylidene)-3-methylsulfonylbenzamide;dihydrochloride (PubChem CID 18788818) has the molecular formula C24H25Cl2N5O5S2 and a molecular weight of 598.53 g/mol. Its IUPAC name is 4-[4-[2-(1H-benzimidazol-2-ylsulfanyl)-1-hydroxyethyl]phenoxy]-N-(diaminomethylidene)-3-methylsulfonylbenzamide;dihydrochloride.
| Compound Name | 4-[4-[2-(1H-benzimidazol-2-ylsulfanyl)-1-hydroxyethyl]phenoxy]-N-(diaminomethylidene)-3-methylsulfonylbenzamide;dihydrochloride |
|---|---|
| PubChem CID | 18788818 |
| Molecular Formula | C24H25Cl2N5O5S2 |
| Molecular Weight | 598.53 g/mol |
| Exact Mass | 597.07 |
| IUPAC Name | 4-[4-[2-(1H-benzimidazol-2-ylsulfanyl)-1-hydroxyethyl]phenoxy]-N-(diaminomethylidene)-3-methylsulfonylbenzamide;dihydrochloride |
| SMILES | CS(=O)(=O)c1cc(C(=O)N=C(N)N)ccc1Oc1ccc(C(O)CSc2nc3ccccc3[nH]2)cc1.Cl.Cl |
| InChI | InChI=1S/C24H23N5O5S2.2ClH/c1-36(32,33)21-12-15(22(31)29-23(25)26)8-11-20(21)34-16-9-6-14(7-10-16)19(30)13-35-24-27-17-4-2-3-5-18(17)28-24;;/h2-12,19,30H,13H2,1H3,(H,27,28)(H4,25,26,29,31);2*1H |
| InChIKey | BGACWQJBTPHUKV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 173.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|