C19H25Cl2N5O5S — CID 70266490
N-(diaminomethylidene)-4-[4-[[2-(dimethylamino)acetyl]amino]phenoxy]-3-methylsulfonylbenzamide;dihydrochloride (PubChem CID 70266490) has the molecular formula C19H25Cl2N5O5S and a molecular weight of 506.41 g/mol. Its IUPAC name is N-(diaminomethylidene)-4-[4-[[2-(dimethylamino)acetyl]amino]phenoxy]-3-methylsulfonylbenzamide;dihydrochloride.
| Compound Name | N-(diaminomethylidene)-4-[4-[[2-(dimethylamino)acetyl]amino]phenoxy]-3-methylsulfonylbenzamide;dihydrochloride |
|---|---|
| PubChem CID | 70266490 |
| Molecular Formula | C19H25Cl2N5O5S |
| Molecular Weight | 506.41 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | N-(diaminomethylidene)-4-[4-[[2-(dimethylamino)acetyl]amino]phenoxy]-3-methylsulfonylbenzamide;dihydrochloride |
| SMILES | CN(C)CC(=O)Nc1ccc(Oc2ccc(C(=O)N=C(N)N)cc2S(C)(=O)=O)cc1.Cl.Cl |
| InChI | InChI=1S/C19H23N5O5S.2ClH/c1-24(2)11-17(25)22-13-5-7-14(8-6-13)29-15-9-4-12(18(26)23-19(20)21)10-16(15)30(3,27)28;;/h4-10H,11H2,1-3H3,(H,22,25)(H4,20,21,23,26);2*1H |
| InChIKey | HIZCHXLJXCECQA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 157.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|