C19H23N5O5S — CID 54512610
N-(diaminomethylidene)-4-[4-[[2-(dimethylamino)acetyl]amino]phenoxy]-3-methylperoxysulfanylbenzamide (PubChem CID 54512610) has the molecular formula C19H23N5O5S and a molecular weight of 433.49 g/mol. Its IUPAC name is N-(diaminomethylidene)-4-[4-[[2-(dimethylamino)acetyl]amino]phenoxy]-3-methylperoxysulfanylbenzamide.
| Compound Name | N-(diaminomethylidene)-4-[4-[[2-(dimethylamino)acetyl]amino]phenoxy]-3-methylperoxysulfanylbenzamide |
|---|---|
| PubChem CID | 54512610 |
| Molecular Formula | C19H23N5O5S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | N-(diaminomethylidene)-4-[4-[[2-(dimethylamino)acetyl]amino]phenoxy]-3-methylperoxysulfanylbenzamide |
| SMILES | COOSc1cc(C(=O)N=C(N)N)ccc1Oc1ccc(NC(=O)CN(C)C)cc1 |
| InChI | InChI=1S/C19H23N5O5S/c1-24(2)11-17(25)22-13-5-7-14(8-6-13)28-15-9-4-12(18(26)23-19(20)21)10-16(15)30-29-27-3/h4-10H,11H2,1-3H3,(H,22,25)(H4,20,21,23,26) |
| InChIKey | YKEXUDNTOKUDHF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 141.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|