C11H18ClN3O2 — CID 67315900
N-(3-amino-4-methoxyphenyl)-2-(dimethylamino)acetamide;hydrochloride (PubChem CID 67315900) has the molecular formula C11H18ClN3O2 and a molecular weight of 259.74 g/mol. Its IUPAC name is N-(3-amino-4-methoxyphenyl)-2-(dimethylamino)acetamide;hydrochloride.
| Compound Name | N-(3-amino-4-methoxyphenyl)-2-(dimethylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 67315900 |
| Molecular Formula | C11H18ClN3O2 |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | N-(3-amino-4-methoxyphenyl)-2-(dimethylamino)acetamide;hydrochloride |
| SMILES | COc1ccc(NC(=O)CN(C)C)cc1N.Cl |
| InChI | InChI=1S/C11H17N3O2.ClH/c1-14(2)7-11(15)13-8-4-5-10(16-3)9(12)6-8;/h4-6H,7,12H2,1-3H3,(H,13,15);1H |
| InChIKey | CGIKAUUVQFPWGH-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|