C19H25ClN4O3 — CID 119419694
N-(3-amino-4-methoxyphenyl)-3-[[benzyl(methyl)carbamoyl]amino]propanamide;hydrochloride (PubChem CID 119419694) has the molecular formula C19H25ClN4O3 and a molecular weight of 392.89 g/mol. Its IUPAC name is N-(3-amino-4-methoxyphenyl)-3-[[benzyl(methyl)carbamoyl]amino]propanamide;hydrochloride.
| Compound Name | N-(3-amino-4-methoxyphenyl)-3-[[benzyl(methyl)carbamoyl]amino]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119419694 |
| Molecular Formula | C19H25ClN4O3 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | N-(3-amino-4-methoxyphenyl)-3-[[benzyl(methyl)carbamoyl]amino]propanamide;hydrochloride |
| SMILES | COc1ccc(NC(=O)CCNC(=O)N(C)Cc2ccccc2)cc1N.Cl |
| InChI | InChI=1S/C19H24N4O3.ClH/c1-23(13-14-6-4-3-5-7-14)19(25)21-11-10-18(24)22-15-8-9-17(26-2)16(20)12-15;/h3-9,12H,10-11,13,20H2,1-2H3,(H,21,25)(H,22,24);1H |
| InChIKey | JDOWKOMUEMIRGF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|