C19H19ClN4O5S — CID 19360561
(3-methylsulfonyl-4-quinolin-6-yloxyphenyl)methyl N-(diaminomethylidene)carbamate;hydrochloride (PubChem CID 19360561) has the molecular formula C19H19ClN4O5S and a molecular weight of 450.90 g/mol. Its IUPAC name is (3-methylsulfonyl-4-quinolin-6-yloxyphenyl)methyl N-(diaminomethylidene)carbamate;hydrochloride.
| Compound Name | (3-methylsulfonyl-4-quinolin-6-yloxyphenyl)methyl N-(diaminomethylidene)carbamate;hydrochloride |
|---|---|
| PubChem CID | 19360561 |
| Molecular Formula | C19H19ClN4O5S |
| Molecular Weight | 450.90 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | (3-methylsulfonyl-4-quinolin-6-yloxyphenyl)methyl N-(diaminomethylidene)carbamate;hydrochloride |
| SMILES | CS(=O)(=O)c1cc(COC(=O)N=C(N)N)ccc1Oc1ccc2ncccc2c1.Cl |
| InChI | InChI=1S/C19H18N4O5S.ClH/c1-29(25,26)17-9-12(11-27-19(24)23-18(20)21)4-7-16(17)28-14-5-6-15-13(10-14)3-2-8-22-15;/h2-10H,11H2,1H3,(H4,20,21,23,24);1H |
| InChIKey | ORQKKOLRTFWVNP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 146.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.90 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|