About quinolin-6-yl 2-(diaminomethylideneamino)acetate
quinolin-6-yl 2-(diaminomethylideneamino)acetate (PubChem CID 174221629) has the molecular formula C12H12N4O2
and a molecular weight of 244.25 g/mol. Its IUPAC name is quinolin-6-yl 2-(diaminomethylideneamino)acetate.
Molecular Properties
| Compound Name | quinolin-6-yl 2-(diaminomethylideneamino)acetate |
| PubChem CID | 174221629 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | quinolin-6-yl 2-(diaminomethylideneamino)acetate |
| SMILES | NC(N)=NCC(=O)Oc1ccc2ncccc2c1 |
| InChI | InChI=1S/C12H12N4O2/c13-12(14)16-7-11(17)18-9-3-4-10-8(6-9)2-1-5-15-10/h1-6H,7H2,(H4,13,14,16) |
| InChIKey | ADOMGQBXUFKMQZ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze quinolin-6-yl 2-(diaminomethylideneamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-6-yl 2-(diaminomethylideneamino)acetate?
The IUPAC name of quinolin-6-yl 2-(diaminomethylideneamino)acetate (CID 174221629) is quinolin-6-yl 2-(diaminomethylideneamino)acetate.
What is the SMILES notation for quinolin-6-yl 2-(diaminomethylideneamino)acetate?
The canonical SMILES for quinolin-6-yl 2-(diaminomethylideneamino)acetate is NC(N)=NCC(=O)Oc1ccc2ncccc2c1.
What is the InChIKey of quinolin-6-yl 2-(diaminomethylideneamino)acetate?
The InChIKey is ADOMGQBXUFKMQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4O2/c13-12(14)16-7-11(17)18-9-3-4-10-8(6-9)2-1-5-15-10/h1-6H,7H2,(H4,13,14,16).
What are the key properties of quinolin-6-yl 2-(diaminomethylideneamino)acetate?
quinolin-6-yl 2-(diaminomethylideneamino)acetate has a molecular weight of 244.25 g/mol, XLogP of 0.41, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-6-yl 2-(diaminomethylideneamino)acetate is sourced from PubChem (CID 174221629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).