C12H18N4O4S2 — CID 19096033
4-butylsulfinyl-N-(diaminomethylidene)-3-sulfamoylbenzamide (PubChem CID 19096033) has the molecular formula C12H18N4O4S2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 4-butylsulfinyl-N-(diaminomethylidene)-3-sulfamoylbenzamide.
| Compound Name | 4-butylsulfinyl-N-(diaminomethylidene)-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 19096033 |
| Molecular Formula | C12H18N4O4S2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 4-butylsulfinyl-N-(diaminomethylidene)-3-sulfamoylbenzamide |
| SMILES | CCCCS(=O)c1ccc(C(=O)N=C(N)N)cc1S(N)(=O)=O |
| InChI | InChI=1S/C12H18N4O4S2/c1-2-3-6-21(18)9-5-4-8(11(17)16-12(13)14)7-10(9)22(15,19)20/h4-5,7H,2-3,6H2,1H3,(H2,15,19,20)(H4,13,14,16,17) |
| InChIKey | ZZPHRFWDYPQYOB-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 158.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|