C9H11ClF2N4O — CID 19360530
1-(diaminomethylidene)-3-[(2,5-difluorophenyl)methyl]urea;hydrochloride (PubChem CID 19360530) has the molecular formula C9H11ClF2N4O and a molecular weight of 264.66 g/mol. Its IUPAC name is 1-(diaminomethylidene)-3-[(2,5-difluorophenyl)methyl]urea;hydrochloride.
| Compound Name | 1-(diaminomethylidene)-3-[(2,5-difluorophenyl)methyl]urea;hydrochloride |
|---|---|
| PubChem CID | 19360530 |
| Molecular Formula | C9H11ClF2N4O |
| Molecular Weight | 264.66 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 1-(diaminomethylidene)-3-[(2,5-difluorophenyl)methyl]urea;hydrochloride |
| SMILES | Cl.NC(N)=NC(=O)NCc1cc(F)ccc1F |
| InChI | InChI=1S/C9H10F2N4O.ClH/c10-6-1-2-7(11)5(3-6)4-14-9(16)15-8(12)13;/h1-3H,4H2,(H5,12,13,14,15,16);1H |
| InChIKey | FYGQFSWSLTWXEY-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.66 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|