C10H13F2N3O — CID 83111439
2-[(2,5-difluorophenyl)methylamino]ethylurea (PubChem CID 83111439) has the molecular formula C10H13F2N3O and a molecular weight of 229.23 g/mol. Its IUPAC name is 2-[(2,5-difluorophenyl)methylamino]ethylurea.
| Compound Name | 2-[(2,5-difluorophenyl)methylamino]ethylurea |
|---|---|
| PubChem CID | 83111439 |
| Molecular Formula | C10H13F2N3O |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 2-[(2,5-difluorophenyl)methylamino]ethylurea |
| SMILES | NC(=O)NCCNCc1cc(F)ccc1F |
| InChI | InChI=1S/C10H13F2N3O/c11-8-1-2-9(12)7(5-8)6-14-3-4-15-10(13)16/h1-2,5,14H,3-4,6H2,(H3,13,15,16) |
| InChIKey | BOINKOJCBJAMEP-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|