C12H12F2N2O4 — CID 63792431
4-[(2,5-difluorophenyl)methylcarbamoylamino]-4-oxobutanoic acid (PubChem CID 63792431) has the molecular formula C12H12F2N2O4 and a molecular weight of 286.23 g/mol. Its IUPAC name is 4-[(2,5-difluorophenyl)methylcarbamoylamino]-4-oxobutanoic acid.
| Compound Name | 4-[(2,5-difluorophenyl)methylcarbamoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 63792431 |
| Molecular Formula | C12H12F2N2O4 |
| Molecular Weight | 286.23 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 4-[(2,5-difluorophenyl)methylcarbamoylamino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)NC(=O)NCc1cc(F)ccc1F |
| InChI | InChI=1S/C12H12F2N2O4/c13-8-1-2-9(14)7(5-8)6-15-12(20)16-10(17)3-4-11(18)19/h1-2,5H,3-4,6H2,(H,18,19)(H2,15,16,17,20) |
| InChIKey | ZTKVWKMCNMIRPS-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |