C19H16F4N2O2 — CID 155513092
N,N'-bis[(2,5-difluorophenyl)methyl]-2-methylidenebutanediamide (PubChem CID 155513092) has the molecular formula C19H16F4N2O2 and a molecular weight of 380.34 g/mol. Its IUPAC name is N,N'-bis[(2,5-difluorophenyl)methyl]-2-methylidenebutanediamide.
| Compound Name | N,N'-bis[(2,5-difluorophenyl)methyl]-2-methylidenebutanediamide |
|---|---|
| PubChem CID | 155513092 |
| Molecular Formula | C19H16F4N2O2 |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | N,N'-bis[(2,5-difluorophenyl)methyl]-2-methylidenebutanediamide |
| SMILES | C=C(CC(=O)NCc1cc(F)ccc1F)C(=O)NCc1cc(F)ccc1F |
| InChI | InChI=1S/C19H16F4N2O2/c1-11(19(27)25-10-13-8-15(21)3-5-17(13)23)6-18(26)24-9-12-7-14(20)2-4-16(12)22/h2-5,7-8H,1,6,9-10H2,(H,24,26)(H,25,27) |
| InChIKey | WVYPZUNFKHYOLA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|