C9H9F2N3O2 — CID 63791911
N-[(2,5-difluorophenyl)methyl]-2-hydrazinyl-2-oxoacetamide (PubChem CID 63791911) has the molecular formula C9H9F2N3O2 and a molecular weight of 229.19 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-2-hydrazinyl-2-oxoacetamide.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-2-hydrazinyl-2-oxoacetamide |
|---|---|
| PubChem CID | 63791911 |
| Molecular Formula | C9H9F2N3O2 |
| Molecular Weight | 229.19 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-2-hydrazinyl-2-oxoacetamide |
| SMILES | NNC(=O)C(=O)NCc1cc(F)ccc1F |
| InChI | InChI=1S/C9H9F2N3O2/c10-6-1-2-7(11)5(3-6)4-13-8(15)9(16)14-12/h1-3H,4,12H2,(H,13,15)(H,14,16) |
| InChIKey | KNEQYGAXIVCJTC-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.19 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|