C11H15F2N3O — CID 77028287
4-[(2,5-difluorophenyl)methylamino]-N'-hydroxybutanimidamide (PubChem CID 77028287) has the molecular formula C11H15F2N3O and a molecular weight of 243.26 g/mol. Its IUPAC name is 4-[(2,5-difluorophenyl)methylamino]-N'-hydroxybutanimidamide.
| Compound Name | 4-[(2,5-difluorophenyl)methylamino]-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 77028287 |
| Molecular Formula | C11H15F2N3O |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 4-[(2,5-difluorophenyl)methylamino]-N'-hydroxybutanimidamide |
| SMILES | NC(CCCNCc1cc(F)ccc1F)=NO |
| InChI | InChI=1S/C11H15F2N3O/c12-9-3-4-10(13)8(6-9)7-15-5-1-2-11(14)16-17/h3-4,6,15,17H,1-2,5,7H2,(H2,14,16) |
| InChIKey | XBCDEFUQAPZPIP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|