C11H12F2O — CID 83831494
2-[(2,5-difluorophenyl)methyl]butanal (PubChem CID 83831494) has the molecular formula C11H12F2O and a molecular weight of 198.21 g/mol. Its IUPAC name is 2-[(2,5-difluorophenyl)methyl]butanal.
| Compound Name | 2-[(2,5-difluorophenyl)methyl]butanal |
|---|---|
| PubChem CID | 83831494 |
| Molecular Formula | C11H12F2O |
| Molecular Weight | 198.21 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 2-[(2,5-difluorophenyl)methyl]butanal |
| SMILES | CCC(C=O)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C11H12F2O/c1-2-8(7-14)5-9-6-10(12)3-4-11(9)13/h3-4,6-8H,2,5H2,1H3 |
| InChIKey | VFDYYAWVANIZKB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.21 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|