C18H22O3 — CID 101303320
2,4-diethyl-6-(3-ethylphenyl)benzene-1,3,5-triol (PubChem CID 101303320) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is 2,4-diethyl-6-(3-ethylphenyl)benzene-1,3,5-triol.
| Compound Name | 2,4-diethyl-6-(3-ethylphenyl)benzene-1,3,5-triol |
|---|---|
| PubChem CID | 101303320 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 2,4-diethyl-6-(3-ethylphenyl)benzene-1,3,5-triol |
| SMILES | CCc1cccc(-c2c(O)c(CC)c(O)c(CC)c2O)c1 |
| InChI | InChI=1S/C18H22O3/c1-4-11-8-7-9-12(10-11)15-17(20)13(5-2)16(19)14(6-3)18(15)21/h7-10,19-21H,4-6H2,1-3H3 |
| InChIKey | SIEZJYANRZYXLD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |