C15H18 — CID 139831018
1-ethyl-3-(4-ethylcyclopenta-1,4-dien-1-yl)benzene (PubChem CID 139831018) has the molecular formula C15H18 and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-ethyl-3-(4-ethylcyclopenta-1,4-dien-1-yl)benzene.
| Compound Name | 1-ethyl-3-(4-ethylcyclopenta-1,4-dien-1-yl)benzene |
|---|---|
| PubChem CID | 139831018 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 1-ethyl-3-(4-ethylcyclopenta-1,4-dien-1-yl)benzene |
| SMILES | CCC1=CC(c2cccc(CC)c2)=CC1 |
| InChI | InChI=1S/C15H18/c1-3-12-6-5-7-14(10-12)15-9-8-13(4-2)11-15/h5-7,9-11H,3-4,8H2,1-2H3 |
| InChIKey | GRUVPUDMISBZIG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |