C12H14S — CID 142267834
5-(3-ethylphenyl)-2,3-dihydrothiophene (PubChem CID 142267834) has the molecular formula C12H14S and a molecular weight of 190.31 g/mol. Its IUPAC name is 5-(3-ethylphenyl)-2,3-dihydrothiophene.
| Compound Name | 5-(3-ethylphenyl)-2,3-dihydrothiophene |
|---|---|
| PubChem CID | 142267834 |
| Molecular Formula | C12H14S |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 5-(3-ethylphenyl)-2,3-dihydrothiophene |
| SMILES | CCc1cccc(C2=CCCS2)c1 |
| InChI | InChI=1S/C12H14S/c1-2-10-5-3-6-11(9-10)12-7-4-8-13-12/h3,5-7,9H,2,4,8H2,1H3 |
| InChIKey | VYSKQNYVTRFJNK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |