C9H15N3O2S3 — CID 103414629
2-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]butanethioamide (PubChem CID 103414629) has the molecular formula C9H15N3O2S3 and a molecular weight of 293.44 g/mol. Its IUPAC name is 2-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]butanethioamide.
| Compound Name | 2-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]butanethioamide |
|---|---|
| PubChem CID | 103414629 |
| Molecular Formula | C9H15N3O2S3 |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 2-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]butanethioamide |
| SMILES | CCC(C)(NS(=O)(=O)c1cnc(C)s1)C(N)=S |
| InChI | InChI=1S/C9H15N3O2S3/c1-4-9(3,8(10)15)12-17(13,14)7-5-11-6(2)16-7/h5,12H,4H2,1-3H3,(H2,10,15) |
| InChIKey | PFUUHQZIQDEHIN-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|