C10H15BrN2O2S3 — CID 79989092
2-[(5-bromo-4-methylthiophen-2-yl)sulfonylamino]-2-methylbutanethioamide (PubChem CID 79989092) has the molecular formula C10H15BrN2O2S3 and a molecular weight of 371.35 g/mol. Its IUPAC name is 2-[(5-bromo-4-methylthiophen-2-yl)sulfonylamino]-2-methylbutanethioamide.
| Compound Name | 2-[(5-bromo-4-methylthiophen-2-yl)sulfonylamino]-2-methylbutanethioamide |
|---|---|
| PubChem CID | 79989092 |
| Molecular Formula | C10H15BrN2O2S3 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 369.95 |
| IUPAC Name | 2-[(5-bromo-4-methylthiophen-2-yl)sulfonylamino]-2-methylbutanethioamide |
| SMILES | CCC(C)(NS(=O)(=O)c1cc(C)c(Br)s1)C(N)=S |
| InChI | InChI=1S/C10H15BrN2O2S3/c1-4-10(3,9(12)16)13-18(14,15)7-5-6(2)8(11)17-7/h5,13H,4H2,1-3H3,(H2,12,16) |
| InChIKey | HNOHCZKBIBQUDJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|