C7H18N4O2S — CID 114813617
3-(ethylsulfamoylamino)-2,2-dimethylpropanimidamide (PubChem CID 114813617) has the molecular formula C7H18N4O2S and a molecular weight of 222.31 g/mol. Its IUPAC name is 3-(ethylsulfamoylamino)-2,2-dimethylpropanimidamide.
| Compound Name | 3-(ethylsulfamoylamino)-2,2-dimethylpropanimidamide |
|---|---|
| PubChem CID | 114813617 |
| Molecular Formula | C7H18N4O2S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 3-(ethylsulfamoylamino)-2,2-dimethylpropanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CNS(=O)(=O)NCC |
| InChI | InChI=1S/C7H18N4O2S/c1-4-10-14(12,13)11-5-7(2,3)6(8)9/h10-11H,4-5H2,1-3H3,(H3,8,9) |
| InChIKey | IDBKKSOVYIWOJH-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|