C14H23N3O2S — CID 80688313
2-methyl-2-(2-phenylpropylsulfonylamino)butanimidamide (PubChem CID 80688313) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is 2-methyl-2-(2-phenylpropylsulfonylamino)butanimidamide.
| Compound Name | 2-methyl-2-(2-phenylpropylsulfonylamino)butanimidamide |
|---|---|
| PubChem CID | 80688313 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-methyl-2-(2-phenylpropylsulfonylamino)butanimidamide |
| SMILES | [H]/N=C(\N)C(C)(CC)NS(=O)(=O)CC(C)c1ccccc1 |
| InChI | InChI=1S/C14H23N3O2S/c1-4-14(3,13(15)16)17-20(18,19)10-11(2)12-8-6-5-7-9-12/h5-9,11,17H,4,10H2,1-3H3,(H3,15,16) |
| InChIKey | UJMAUBXYPOAHRK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|