C13H21N3O2S — CID 80687571
4-(2-phenylpropylsulfonylamino)butanimidamide (PubChem CID 80687571) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is 4-(2-phenylpropylsulfonylamino)butanimidamide.
| Compound Name | 4-(2-phenylpropylsulfonylamino)butanimidamide |
|---|---|
| PubChem CID | 80687571 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 4-(2-phenylpropylsulfonylamino)butanimidamide |
| SMILES | [H]/N=C(\N)CCCNS(=O)(=O)CC(C)c1ccccc1 |
| InChI | InChI=1S/C13H21N3O2S/c1-11(12-6-3-2-4-7-12)10-19(17,18)16-9-5-8-13(14)15/h2-4,6-7,11,16H,5,8-10H2,1H3,(H3,14,15) |
| InChIKey | WAUHZJGIRULDDJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|