About 3-phenylbutanimidamide;hydrochloride
3-phenylbutanimidamide;hydrochloride (PubChem CID 69158161) has the molecular formula C10H15ClN2
and a molecular weight of 198.70 g/mol. Its IUPAC name is 3-phenylbutanimidamide;hydrochloride.
Molecular Properties
| Compound Name | 3-phenylbutanimidamide;hydrochloride |
| PubChem CID | 69158161 |
| Molecular Formula | C10H15ClN2 |
| Molecular Weight | 198.70 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 3-phenylbutanimidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)CC(C)c1ccccc1 |
| InChI | InChI=1S/C10H14N2.ClH/c1-8(7-10(11)12)9-5-3-2-4-6-9;/h2-6,8H,7H2,1H3,(H3,11,12);1H |
| InChIKey | VRLRFDAGVMHDPS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.70 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylbutanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylbutanimidamide;hydrochloride?
The IUPAC name of 3-phenylbutanimidamide;hydrochloride (CID 69158161) is 3-phenylbutanimidamide;hydrochloride.
What is the SMILES notation for 3-phenylbutanimidamide;hydrochloride?
The canonical SMILES for 3-phenylbutanimidamide;hydrochloride is Cl.[H]/N=C(\N)CC(C)c1ccccc1.
What is the InChIKey of 3-phenylbutanimidamide;hydrochloride?
The InChIKey is VRLRFDAGVMHDPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2.ClH/c1-8(7-10(11)12)9-5-3-2-4-6-9;/h2-6,8H,7H2,1H3,(H3,11,12);1H.
What are the key properties of 3-phenylbutanimidamide;hydrochloride?
3-phenylbutanimidamide;hydrochloride has a molecular weight of 198.70 g/mol, XLogP of 2.54, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylbutanimidamide;hydrochloride is sourced from PubChem (CID 69158161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).