About 3-phenoxybutanimidamide
3-phenoxybutanimidamide (PubChem CID 114995804) has the molecular formula C10H14N2O
and a molecular weight of 178.24 g/mol. Its IUPAC name is 3-phenoxybutanimidamide.
Molecular Properties
| Compound Name | 3-phenoxybutanimidamide |
| PubChem CID | 114995804 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 3-phenoxybutanimidamide |
| SMILES | [H]/N=C(\N)CC(C)Oc1ccccc1 |
| InChI | InChI=1S/C10H14N2O/c1-8(7-10(11)12)13-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H3,11,12) |
| InChIKey | LWRRKRFWESJVIP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-phenoxybutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenoxybutanimidamide?
The IUPAC name of 3-phenoxybutanimidamide (CID 114995804) is 3-phenoxybutanimidamide.
What is the SMILES notation for 3-phenoxybutanimidamide?
The canonical SMILES for 3-phenoxybutanimidamide is [H]/N=C(\N)CC(C)Oc1ccccc1.
What is the InChIKey of 3-phenoxybutanimidamide?
The InChIKey is LWRRKRFWESJVIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O/c1-8(7-10(11)12)13-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H3,11,12).
What are the key properties of 3-phenoxybutanimidamide?
3-phenoxybutanimidamide has a molecular weight of 178.24 g/mol, XLogP of 1.78, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenoxybutanimidamide is sourced from PubChem (CID 114995804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).