2-(2,2-dimethylpropylsulfonylamino)-2-methylbutanoic acid

C10H21NO4S — CID 79792159

IUPAC2-(2,2-dimethylpropylsulfonylamino)-2-methylbutanoic acid
SMILESCCC(C)(NS(=O)(=O)CC(C)(C)C)C(=O)O
InChIInChI=1S/C10H21NO4S/c1-6-10(5,8(12)13)11-16(14,15)7-9(2,3)4/h11H,6-7H2,1-5H3,(H,12,13)
InChIKeyOEAZYPWTHTWICT-UHFFFAOYSA-N
MW251.35 g/mol
LogP1.21
Rot. Bonds5

About 2-(2,2-dimethylpropylsulfonylamino)-2-methylbutanoic acid

2-(2,2-dimethylpropylsulfonylamino)-2-methylbutanoic acid (PubChem CID 79792159) has the molecular formula C10H21NO4S and a molecular weight of 251.35 g/mol. Its IUPAC name is 2-(2,2-dimethylpropylsulfonylamino)-2-methylbutanoic acid.

Molecular Properties

Compound Name2-(2,2-dimethylpropylsulfonylamino)-2-methylbutanoic acid
PubChem CID79792159
Molecular FormulaC10H21NO4S
Molecular Weight251.35 g/mol
Exact Mass251.12
IUPAC Name2-(2,2-dimethylpropylsulfonylamino)-2-methylbutanoic acid
SMILESCCC(C)(NS(=O)(=O)CC(C)(C)C)C(=O)O
InChIInChI=1S/C10H21NO4S/c1-6-10(5,8(12)13)11-16(14,15)7-9(2,3)4/h11H,6-7H2,1-5H3,(H,12,13)
InChIKeyOEAZYPWTHTWICT-UHFFFAOYSA-N
XLogP1.21
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.35
LogP ≤ 51.21
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(2,2-dimethylpropylsulfonylamino)-2-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,2-dimethylpropylsulfonylamino)-2-methylbutanoic acid?
The IUPAC name of 2-(2,2-dimethylpropylsulfonylamino)-2-methylbutanoic acid (CID 79792159) is 2-(2,2-dimethylpropylsulfonylamino)-2-methylbutanoic acid.
What is the SMILES notation for 2-(2,2-dimethylpropylsulfonylamino)-2-methylbutanoic acid?
The canonical SMILES for 2-(2,2-dimethylpropylsulfonylamino)-2-methylbutanoic acid is CCC(C)(NS(=O)(=O)CC(C)(C)C)C(=O)O.
What is the InChIKey of 2-(2,2-dimethylpropylsulfonylamino)-2-methylbutanoic acid?
The InChIKey is OEAZYPWTHTWICT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO4S/c1-6-10(5,8(12)13)11-16(14,15)7-9(2,3)4/h11H,6-7H2,1-5H3,(H,12,13).
What are the key properties of 2-(2,2-dimethylpropylsulfonylamino)-2-methylbutanoic acid?
2-(2,2-dimethylpropylsulfonylamino)-2-methylbutanoic acid has a molecular weight of 251.35 g/mol, XLogP of 1.21, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylpropylsulfonylamino)-2-methylbutanoic acid is sourced from PubChem (CID 79792159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).