C8H17N3O2S2 — CID 114959147
4-methyl-1-(sulfamoylamino)cyclohexane-1-carbothioamide (PubChem CID 114959147) has the molecular formula C8H17N3O2S2 and a molecular weight of 251.38 g/mol. Its IUPAC name is 4-methyl-1-(sulfamoylamino)cyclohexane-1-carbothioamide.
| Compound Name | 4-methyl-1-(sulfamoylamino)cyclohexane-1-carbothioamide |
|---|---|
| PubChem CID | 114959147 |
| Molecular Formula | C8H17N3O2S2 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 4-methyl-1-(sulfamoylamino)cyclohexane-1-carbothioamide |
| SMILES | CC1CCC(NS(N)(=O)=O)(C(N)=S)CC1 |
| InChI | InChI=1S/C8H17N3O2S2/c1-6-2-4-8(5-3-6,7(9)14)11-15(10,12)13/h6,11H,2-5H2,1H3,(H2,9,14)(H2,10,12,13) |
| InChIKey | PRIJHAYMIGQFCK-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|