C8H18N4O3S — CID 104985759
N'-hydroxy-4-methyl-1-(sulfamoylamino)cyclohexane-1-carboximidamide (PubChem CID 104985759) has the molecular formula C8H18N4O3S and a molecular weight of 250.32 g/mol. Its IUPAC name is N'-hydroxy-4-methyl-1-(sulfamoylamino)cyclohexane-1-carboximidamide.
| Compound Name | N'-hydroxy-4-methyl-1-(sulfamoylamino)cyclohexane-1-carboximidamide |
|---|---|
| PubChem CID | 104985759 |
| Molecular Formula | C8H18N4O3S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | N'-hydroxy-4-methyl-1-(sulfamoylamino)cyclohexane-1-carboximidamide |
| SMILES | CC1CCC(NS(N)(=O)=O)(C(N)=NO)CC1 |
| InChI | InChI=1S/C8H18N4O3S/c1-6-2-4-8(5-3-6,7(9)11-13)12-16(10,14)15/h6,12-13H,2-5H2,1H3,(H2,9,11)(H2,10,14,15) |
| InChIKey | SRNPTRWQDJFIDX-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|