C8H18N4O3S — CID 104978316
1-(ethylsulfamoylamino)-N'-hydroxycyclopentane-1-carboximidamide (PubChem CID 104978316) has the molecular formula C8H18N4O3S and a molecular weight of 250.32 g/mol. Its IUPAC name is 1-(ethylsulfamoylamino)-N'-hydroxycyclopentane-1-carboximidamide.
| Compound Name | 1-(ethylsulfamoylamino)-N'-hydroxycyclopentane-1-carboximidamide |
|---|---|
| PubChem CID | 104978316 |
| Molecular Formula | C8H18N4O3S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 1-(ethylsulfamoylamino)-N'-hydroxycyclopentane-1-carboximidamide |
| SMILES | CCNS(=O)(=O)NC1(C(N)=NO)CCCC1 |
| InChI | InChI=1S/C8H18N4O3S/c1-2-10-16(14,15)12-8(7(9)11-13)5-3-4-6-8/h10,12-13H,2-6H2,1H3,(H2,9,11) |
| InChIKey | KKZWPQSAZOBFFC-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|