C11H22N4O5S — CID 104929323
ethyl N-[[1-(N'-hydroxycarbamimidoyl)cycloheptyl]sulfamoyl]carbamate (PubChem CID 104929323) has the molecular formula C11H22N4O5S and a molecular weight of 322.39 g/mol. Its IUPAC name is ethyl N-[[1-(N'-hydroxycarbamimidoyl)cycloheptyl]sulfamoyl]carbamate.
| Compound Name | ethyl N-[[1-(N'-hydroxycarbamimidoyl)cycloheptyl]sulfamoyl]carbamate |
|---|---|
| PubChem CID | 104929323 |
| Molecular Formula | C11H22N4O5S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | ethyl N-[[1-(N'-hydroxycarbamimidoyl)cycloheptyl]sulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)NC1(C(N)=NO)CCCCCC1 |
| InChI | InChI=1S/C11H22N4O5S/c1-2-20-10(16)14-21(18,19)15-11(9(12)13-17)7-5-3-4-6-8-11/h15,17H,2-8H2,1H3,(H2,12,13)(H,14,16) |
| InChIKey | MCSVZZXLKTUULM-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 143.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|